Description: Sesterterpene, natural inhibitor of Calmodulin, exhibiting anti-cancer, antibacterial properties. Phytotoxin from a plant pathogen.
Solubility ( literature ): Soluble in ethanol, methanol, DMF or DMSO. Poor water solubility
Applications:
Composition: Ingredient type Fermentek product
Disclaimer: For Research use only, Not for Human or Drug use, Not extracted from humans or animals, Refer to MSDS for further safety and handling instructions
Names and identifiers: Synonyms: Ophiobolin B Ophiobola-7,19-dien-25-al, 3,14-dihydroxy-5-oxo- Cochliobolin B Zizanin B IUPAC: (7E)-3,14-Dihydroxy-5-oxoophiobola-7,19-dien-25-al RTECS# :
Pub 1:
Source: Cochliobolus heterostrophus
Chemical name: Ophiobolin B
InChl Key: CC(CCC=C(C)C)C1(CCC2(C1CC=C(C3C(C2)C(CC3=O)(C)O)C=O)C)O